C20H24NO4S2+ — CID 147021566
[7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-3-oxatricyclo[3.3.1.02,4]nonan-9-yl]-dimethylazanium (PubChem CID 147021566) has the molecular formula C20H24NO4S2+ and a molecular weight of 406.55 g/mol. Its IUPAC name is [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-3-oxatricyclo[3.3.1.02,4]nonan-9-yl]-dimethylazanium.
| Compound Name | [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-3-oxatricyclo[3.3.1.02,4]nonan-9-yl]-dimethylazanium |
|---|---|
| PubChem CID | 147021566 |
| Molecular Formula | C20H24NO4S2+ |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | [7-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-3-oxatricyclo[3.3.1.02,4]nonan-9-yl]-dimethylazanium |
| SMILES | C[NH+](C)C1C2CC(OC(=O)C(O)(c3cccs3)c3cccs3)CC1C1OC21 |
| InChI | InChI=1S/C20H23NO4S2/c1-21(2)16-12-9-11(10-13(16)18-17(12)25-18)24-19(22)20(23,14-5-3-7-26-14)15-6-4-8-27-15/h3-8,11-13,16-18,23H,9-10H2,1-2H3/p+1 |
| InChIKey | AVUTUWGLTYORFZ-UHFFFAOYSA-O |
| XLogP | 1.28 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|