C18H18O4S2 — CID 126581294
[(1S,2S,4R,5R)-3-oxatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 126581294) has the molecular formula C18H18O4S2 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-3-oxatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(1S,2S,4R,5R)-3-oxatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 126581294 |
| Molecular Formula | C18H18O4S2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [(1S,2S,4R,5R)-3-oxatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(OC1C[C@H]2C[C@@H](C1)[C@@H]1O[C@H]21)C(O)(c1cccs1)c1cccs1 |
| InChI | InChI=1S/C18H18O4S2/c19-17(21-12-8-10-7-11(9-12)16-15(10)22-16)18(20,13-3-1-5-23-13)14-4-2-6-24-14/h1-6,10-12,15-16,20H,7-9H2/t10-,11+,12?,15-,16+ |
| InChIKey | JETWVLAUKHXLSX-TYCQUTJGSA-N |
| XLogP | 3.15 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|