C22H25NO8S2 — CID 15979354
(9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate;3-hydroxy-3-oxopropanoate (PubChem CID 15979354) has the molecular formula C22H25NO8S2 and a molecular weight of 495.58 g/mol. Its IUPAC name is (9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate;3-hydroxy-3-oxopropanoate.
| Compound Name | (9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate;3-hydroxy-3-oxopropanoate |
|---|---|
| PubChem CID | 15979354 |
| Molecular Formula | C22H25NO8S2 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.10 |
| IUPAC Name | (9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl) 2-hydroxy-2,2-dithiophen-2-ylacetate;3-hydroxy-3-oxopropanoate |
| SMILES | C[N+]1(C)C2CC(OC(=O)C(O)(c3cccs3)c3cccs3)CC1C1OC12.O=C([O-])CC(=O)O |
| InChI | InChI=1S/C19H22NO4S2.C3H4O4/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15;4-2(5)1-3(6)7/h3-8,11-13,16-17,22H,9-10H2,1-2H3;1H2,(H,4,5)(H,6,7)/q+1;/p-1 |
| InChIKey | ODIVFCACZLIFHJ-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 136.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|