C22H26Cl2N2O4S2 — CID 71664433
acetonitrile;dichloromethane;2-[[(1S,2S,4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl]oxy]-2-oxo-1,1-dithiophen-2-ylethanolate (PubChem CID 71664433) has the molecular formula C22H26Cl2N2O4S2 and a molecular weight of 517.50 g/mol. Its IUPAC name is acetonitrile;dichloromethane;2-[[(1S,2S,4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl]oxy]-2-oxo-1,1-dithiophen-2-ylethanolate.
| Compound Name | acetonitrile;dichloromethane;2-[[(1S,2S,4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl]oxy]-2-oxo-1,1-dithiophen-2-ylethanolate |
|---|---|
| PubChem CID | 71664433 |
| Molecular Formula | C22H26Cl2N2O4S2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | acetonitrile;dichloromethane;2-[[(1S,2S,4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl]oxy]-2-oxo-1,1-dithiophen-2-ylethanolate |
| SMILES | CC#N.C[N+]1(C)[C@H]2CC(OC(=O)C([O-])(c3cccs3)c3cccs3)C[C@H]1[C@H]1O[C@H]12.ClCCl |
| InChI | InChI=1S/C19H21NO4S2.C2H3N.CH2Cl2/c1-20(2)12-9-11(10-13(20)17-16(12)24-17)23-18(21)19(22,14-5-3-7-25-14)15-6-4-8-26-15;1-2-3;2-1-3/h3-8,11-13,16-17H,9-10H2,1-2H3;1H3;1H2/t11?,12-,13-,16-,17+;;/m0../s1 |
| InChIKey | PVORQMJPXWBWIM-LGLQOVJPSA-N |
| XLogP | 3.67 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|