C26H31BrF3NO4 — CID 158849145
[(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]acetate;methane;bromide (PubChem CID 158849145) has the molecular formula C26H31BrF3NO4 and a molecular weight of 558.44 g/mol. Its IUPAC name is [(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]acetate;methane;bromide.
| Compound Name | [(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]acetate;methane;bromide |
|---|---|
| PubChem CID | 158849145 |
| Molecular Formula | C26H31BrF3NO4 |
| Molecular Weight | 558.44 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | [(4R,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2-hydroxy-2-(4-methylphenyl)-2-[4-(trifluoromethyl)phenyl]acetate;methane;bromide |
| SMILES | C.Cc1ccc(C(O)(C(=O)OC2CC3C4O[C@@H]4[C@H](C2)[N+]3(C)C)c2ccc(C(F)(F)F)cc2)cc1.[Br-] |
| InChI | InChI=1S/C25H27F3NO4.CH4.BrH/c1-14-4-6-15(7-5-14)24(31,16-8-10-17(11-9-16)25(26,27)28)23(30)32-18-12-19-21-22(33-21)20(13-18)29(19,2)3;;/h4-11,18-22,31H,12-13H2,1-3H3;1H4;1H/q+1;;/p-1/t18?,19-,20?,21+,22?,24?;;/m0../s1 |
| InChIKey | LKAULBPPDCRJHU-ZLAYBPBQSA-M |
| XLogP | 1.19 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|