C24H26F2NO3+ — CID 10152252
[(1S,2S,4R,5R)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 10152252) has the molecular formula C24H26F2NO3+ and a molecular weight of 414.47 g/mol. Its IUPAC name is [(1S,2S,4R,5R)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | [(1S,2S,4R,5R)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 10152252 |
| Molecular Formula | C24H26F2NO3+ |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [(1S,2S,4R,5R)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-bis(4-fluorophenyl)-2-hydroxyacetate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)C(O)(c3ccc(F)cc3)c3ccc(F)cc3)C[C@H]1[C@H]1C[C@H]12 |
| InChI | InChI=1S/C24H26F2NO3/c1-27(2)21-11-18(12-22(27)20-13-19(20)21)30-23(28)24(29,14-3-7-16(25)8-4-14)15-5-9-17(26)10-6-15/h3-10,18-22,29H,11-13H2,1-2H3/q+1/t18?,19-,20+,21-,22+ |
| InChIKey | YSLYRHBVRJBIPY-DHNKMZDLSA-N |
| XLogP | 3.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|