C25H30NO2+ — CID 90850483
[(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate (PubChem CID 90850483) has the molecular formula C25H30NO2+ and a molecular weight of 376.52 g/mol. Its IUPAC name is [(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate.
| Compound Name | [(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate |
|---|---|
| PubChem CID | 90850483 |
| Molecular Formula | C25H30NO2+ |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | [(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 2,2-diphenylpropanoate |
| SMILES | CC(C(=O)OC1CC2C3C[C@@H]3[C@H](C1)[N+]2(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H30NO2/c1-25(17-10-6-4-7-11-17,18-12-8-5-9-13-18)24(27)28-19-14-22-20-16-21(20)23(15-19)26(22,2)3/h4-13,19-23H,14-16H2,1-3H3/q+1/t19?,20-,21?,22-,23?/m0/s1 |
| InChIKey | DVDODFGVIBTOSX-CWLLNSANSA-N |
| XLogP | 4.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|