C25H28BrNO2 — CID 159367051
[(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate bromide (PubChem CID 159367051) has the molecular formula C25H28BrNO2 and a molecular weight of 454.41 g/mol. Its IUPAC name is [(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate bromide.
| Compound Name | [(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate bromide |
|---|---|
| PubChem CID | 159367051 |
| Molecular Formula | C25H28BrNO2 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | [(4S,5S)-9,9-dimethyl-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 9-methylfluorene-9-carboxylate bromide |
| SMILES | CC1(C(=O)OC2CC3C4C[C@@H]4[C@H](C2)[N+]3(C)C)c2ccccc2-c2ccccc21.[Br-] |
| InChI | InChI=1S/C25H28NO2.BrH/c1-25(20-10-6-4-8-16(20)17-9-5-7-11-21(17)25)24(27)28-15-12-22-18-14-19(18)23(13-15)26(22,2)3;/h4-11,15,18-19,22-23H,12-14H2,1-3H3;1H/q+1;/p-1/t15?,18-,19?,22-,23?;/m0./s1 |
| InChIKey | MTWURSHHYYWKBZ-IXLAXHNHSA-M |
| XLogP | 1.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|