C23H24NO3+ — CID 11396585
[(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 9-hydroxyfluorene-9-carboxylate (PubChem CID 11396585) has the molecular formula C23H24NO3+ and a molecular weight of 362.45 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 9-hydroxyfluorene-9-carboxylate.
| Compound Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 9-hydroxyfluorene-9-carboxylate |
|---|---|
| PubChem CID | 11396585 |
| Molecular Formula | C23H24NO3+ |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | [(1S,5R)-8,8-dimethyl-8-azoniabicyclo[3.2.1]oct-6-en-3-yl] 9-hydroxyfluorene-9-carboxylate |
| SMILES | C[N+]1(C)[C@@H]2C=C[C@H]1CC(OC(=O)C1(O)c3ccccc3-c3ccccc31)C2 |
| InChI | InChI=1S/C23H24NO3/c1-24(2)15-11-12-16(24)14-17(13-15)27-22(25)23(26)20-9-5-3-7-18(20)19-8-4-6-10-21(19)23/h3-12,15-17,26H,13-14H2,1-2H3/q+1/t15-,16+,17? |
| InChIKey | QTVSBPAUPPKXPU-SJPCQFCGSA-N |
| XLogP | 2.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|