C24H24NO4+ — CID 142997988
[(8R)-5,5-dimethyl-5-azoniatricyclo[4.3.0.01,4]non-2-en-8-yl] 9-hydroxyxanthene-9-carboxylate (PubChem CID 142997988) has the molecular formula C24H24NO4+ and a molecular weight of 390.46 g/mol. Its IUPAC name is [(8R)-5,5-dimethyl-5-azoniatricyclo[4.3.0.01,4]non-2-en-8-yl] 9-hydroxyxanthene-9-carboxylate.
| Compound Name | [(8R)-5,5-dimethyl-5-azoniatricyclo[4.3.0.01,4]non-2-en-8-yl] 9-hydroxyxanthene-9-carboxylate |
|---|---|
| PubChem CID | 142997988 |
| Molecular Formula | C24H24NO4+ |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | [(8R)-5,5-dimethyl-5-azoniatricyclo[4.3.0.01,4]non-2-en-8-yl] 9-hydroxyxanthene-9-carboxylate |
| SMILES | C[N+]1(C)C2C=CC23C[C@@H](OC(=O)C2(O)c4ccccc4Oc4ccccc42)CC31 |
| InChI | InChI=1S/C24H24NO4/c1-25(2)20-11-12-23(20)14-15(13-21(23)25)28-22(26)24(27)16-7-3-5-9-18(16)29-19-10-6-4-8-17(19)24/h3-12,15,20-21,27H,13-14H2,1-2H3/q+1/t15-,20?,21?,23?/m0/s1 |
| InChIKey | IPJQMNKNIKDKBX-IEHCXCLUSA-N |
| XLogP | 3.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|