C32H36NO4+ — CID 25134889
[(1S,2R)-2-(9-hydroxyxanthene-9-carbonyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium (PubChem CID 25134889) has the molecular formula C32H36NO4+ and a molecular weight of 498.64 g/mol. Its IUPAC name is [(1S,2R)-2-(9-hydroxyxanthene-9-carbonyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium.
| Compound Name | [(1S,2R)-2-(9-hydroxyxanthene-9-carbonyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium |
|---|---|
| PubChem CID | 25134889 |
| Molecular Formula | C32H36NO4+ |
| Molecular Weight | 498.64 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | [(1S,2R)-2-(9-hydroxyxanthene-9-carbonyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium |
| SMILES | C[N+](C)(CCCc1ccccc1)C1C2CC[C@@H]1[C@H](OC(=O)C1(O)c3ccccc3Oc3ccccc31)C2 |
| InChI | InChI=1S/C32H36NO4/c1-33(2,20-10-13-22-11-4-3-5-12-22)30-23-18-19-24(30)29(21-23)37-31(34)32(35)25-14-6-8-16-27(25)36-28-17-9-7-15-26(28)32/h3-9,11-12,14-17,23-24,29-30,35H,10,13,18-21H2,1-2H3/q+1/t23?,24-,29-,30?/m1/s1 |
| InChIKey | HZDWITSUUVNNFT-BHERSLTISA-N |
| XLogP | 5.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.64 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|