C33H37NO3 — CID 25134947
9-[[(1S,2S)-7-[dimethyl(4-phenylbutyl)azaniumyl]-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]fluoren-9-olate (PubChem CID 25134947) has the molecular formula C33H37NO3 and a molecular weight of 495.66 g/mol. Its IUPAC name is 9-[[(1S,2S)-7-[dimethyl(4-phenylbutyl)azaniumyl]-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]fluoren-9-olate.
| Compound Name | 9-[[(1S,2S)-7-[dimethyl(4-phenylbutyl)azaniumyl]-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]fluoren-9-olate |
|---|---|
| PubChem CID | 25134947 |
| Molecular Formula | C33H37NO3 |
| Molecular Weight | 495.66 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | 9-[[(1S,2S)-7-[dimethyl(4-phenylbutyl)azaniumyl]-2-bicyclo[2.2.1]heptanyl]oxycarbonyl]fluoren-9-olate |
| SMILES | C[N+](C)(CCCCc1ccccc1)C1C2CC[C@@H]1[C@@H](OC(=O)C1([O-])c3ccccc3-c3ccccc31)C2 |
| InChI | InChI=1S/C33H37NO3/c1-34(2,21-11-10-14-23-12-4-3-5-13-23)31-24-19-20-27(31)30(22-24)37-32(35)33(36)28-17-8-6-15-25(28)26-16-7-9-18-29(26)33/h3-9,12-13,15-18,24,27,30-31H,10-11,14,19-22H2,1-2H3/t24?,27-,30+,31?/m1/s1 |
| InChIKey | KPAFEYYVAXIPDJ-XSBPDBKBSA-N |
| XLogP | 5.08 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|