C32H39N2O3+ — CID 58580040
[2-[(2-hydroxy-2,2-diphenylacetyl)amino]-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium (PubChem CID 58580040) has the molecular formula C32H39N2O3+ and a molecular weight of 499.68 g/mol. Its IUPAC name is [2-[(2-hydroxy-2,2-diphenylacetyl)amino]-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium.
| Compound Name | [2-[(2-hydroxy-2,2-diphenylacetyl)amino]-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium |
|---|---|
| PubChem CID | 58580040 |
| Molecular Formula | C32H39N2O3+ |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.30 |
| IUPAC Name | [2-[(2-hydroxy-2,2-diphenylacetyl)amino]-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium |
| SMILES | C[N+](C)(CCCOc1ccccc1)C1C2CCC1C(NC(=O)C(O)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C32H38N2O3/c1-34(2,21-12-22-37-27-17-10-5-11-18-27)30-24-19-20-28(30)29(23-24)33-31(35)32(36,25-13-6-3-7-14-25)26-15-8-4-9-16-26/h3-11,13-18,24,28-30,36H,12,19-23H2,1-2H3/p+1 |
| InChIKey | NODDNIHKDXMRMN-UHFFFAOYSA-O |
| XLogP | 4.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|