C28H34INO4S2 — CID 169424032
[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium iodide (PubChem CID 169424032) has the molecular formula C28H34INO4S2 and a molecular weight of 639.62 g/mol. Its IUPAC name is [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium iodide.
| Compound Name | [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium iodide |
|---|---|
| PubChem CID | 169424032 |
| Molecular Formula | C28H34INO4S2 |
| Molecular Weight | 639.62 g/mol |
| Exact Mass | 639.10 |
| IUPAC Name | [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenoxypropyl)azanium iodide |
| SMILES | C[N+](C)(CCCOc1ccccc1)C1C2CCC1C(OC(=O)C(O)(c1cccs1)c1cccs1)C2.[I-] |
| InChI | InChI=1S/C28H34NO4S2.HI/c1-29(2,15-8-16-32-21-9-4-3-5-10-21)26-20-13-14-22(26)23(19-20)33-27(30)28(31,24-11-6-17-34-24)25-12-7-18-35-25;/h3-7,9-12,17-18,20,22-23,26,31H,8,13-16,19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | JCWOVADJFYFIFU-UHFFFAOYSA-M |
| XLogP | 2.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|