C29H34BrNO3S2 — CID 67347795
[(1S,2R)-7-(1-methyl-4-phenylpiperidin-1-ium-1-yl)-2-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (PubChem CID 67347795) has the molecular formula C29H34BrNO3S2 and a molecular weight of 588.63 g/mol. Its IUPAC name is [(1S,2R)-7-(1-methyl-4-phenylpiperidin-1-ium-1-yl)-2-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide.
| Compound Name | [(1S,2R)-7-(1-methyl-4-phenylpiperidin-1-ium-1-yl)-2-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 67347795 |
| Molecular Formula | C29H34BrNO3S2 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 587.12 |
| IUPAC Name | [(1S,2R)-7-(1-methyl-4-phenylpiperidin-1-ium-1-yl)-2-bicyclo[2.2.1]heptanyl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| SMILES | C[N+]1(C2C3CC[C@@H]2[C@H](OC(=O)C(O)(c2cccs2)c2cccs2)C3)CCC(c2ccccc2)CC1.[Br-] |
| InChI | InChI=1S/C29H34NO3S2.BrH/c1-30(15-13-21(14-16-30)20-7-3-2-4-8-20)27-22-11-12-23(27)24(19-22)33-28(31)29(32,25-9-5-17-34-25)26-10-6-18-35-26;/h2-10,17-18,21-24,27,32H,11-16,19H2,1H3;1H/q+1;/p-1/t21?,22?,23-,24-,27?,30?;/m1./s1 |
| InChIKey | BRFORSIJXCLNTK-JNEIKFLHSA-M |
| XLogP | 2.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|