C23H32INO3S2 — CID 169431381
butyl-[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium iodide (PubChem CID 169431381) has the molecular formula C23H32INO3S2 and a molecular weight of 561.55 g/mol. Its IUPAC name is butyl-[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium iodide.
| Compound Name | butyl-[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium iodide |
|---|---|
| PubChem CID | 169431381 |
| Molecular Formula | C23H32INO3S2 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | butyl-[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethylazanium iodide |
| SMILES | CCCC[N+](C)(C)C1C2CCC1C(OC(=O)C(O)(c1cccs1)c1cccs1)C2.[I-] |
| InChI | InChI=1S/C23H32NO3S2.HI/c1-4-5-12-24(2,3)21-16-10-11-17(21)18(15-16)27-22(25)23(26,19-8-6-13-28-19)20-9-7-14-29-20;/h6-9,13-14,16-18,21,26H,4-5,10-12,15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XZAGIGJAISUHRL-UHFFFAOYSA-M |
| XLogP | 1.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|