C28H34BrNO3S2 — CID 77271382
[2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium bromide (PubChem CID 77271382) has the molecular formula C28H34BrNO3S2 and a molecular weight of 576.62 g/mol. Its IUPAC name is [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium bromide.
| Compound Name | [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium bromide |
|---|---|
| PubChem CID | 77271382 |
| Molecular Formula | C28H34BrNO3S2 |
| Molecular Weight | 576.62 g/mol |
| Exact Mass | 575.12 |
| IUPAC Name | [2-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-7-bicyclo[2.2.1]heptanyl]-dimethyl-(3-phenylpropyl)azanium bromide |
| SMILES | C[N+](C)(CCCc1ccccc1)C1C2CCC1C(OC(=O)C(O)(c1cccs1)c1cccs1)C2.[Br-] |
| InChI | InChI=1S/C28H34NO3S2.BrH/c1-29(2,16-6-11-20-9-4-3-5-10-20)26-21-14-15-22(26)23(19-21)32-27(30)28(31,24-12-7-17-33-24)25-13-8-18-34-25;/h3-5,7-10,12-13,17-18,21-23,26,31H,6,11,14-16,19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | XWMWOGJZAXXIPE-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.62 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|