C19H24BrNO3S2 — CID 44545006
[(3R)-1-ethyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (PubChem CID 44545006) has the molecular formula C19H24BrNO3S2 and a molecular weight of 458.44 g/mol. Its IUPAC name is [(3R)-1-ethyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide.
| Compound Name | [(3R)-1-ethyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 44545006 |
| Molecular Formula | C19H24BrNO3S2 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | [(3R)-1-ethyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| SMILES | CC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2.[Br-] |
| InChI | InChI=1S/C19H24NO3S2.BrH/c1-2-20-9-7-14(8-10-20)15(13-20)23-18(21)19(22,16-5-3-11-24-16)17-6-4-12-25-17;/h3-6,11-12,14-15,22H,2,7-10,13H2,1H3;1H/q+1;/p-1/t14?,15-,20?;/m0./s1 |
| InChIKey | LBBPXEBWDCJIBZ-BKFPCSBHSA-M |
| XLogP | 0.22 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|