C24H24BrF2NO3S2 — CID 44545225
[(3R)-1-[(3,5-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (PubChem CID 44545225) has the molecular formula C24H24BrF2NO3S2 and a molecular weight of 556.49 g/mol. Its IUPAC name is [(3R)-1-[(3,5-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide.
| Compound Name | [(3R)-1-[(3,5-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 44545225 |
| Molecular Formula | C24H24BrF2NO3S2 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 555.03 |
| IUPAC Name | [(3R)-1-[(3,5-difluorophenyl)methyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| SMILES | O=C(O[C@H]1C[N+]2(Cc3cc(F)cc(F)c3)CCC1CC2)C(O)(c1cccs1)c1cccs1.[Br-] |
| InChI | InChI=1S/C24H24F2NO3S2.BrH/c25-18-11-16(12-19(26)13-18)14-27-7-5-17(6-8-27)20(15-27)30-23(28)24(29,21-3-1-9-31-21)22-4-2-10-32-22;/h1-4,9-13,17,20,29H,5-8,14-15H2;1H/q+1;/p-1/t17?,20-,27?;/m0./s1 |
| InChIKey | BNZUIQQRPGRWOT-COHLRNJRSA-M |
| XLogP | 1.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|