C19H26BrNO3S — CID 11327813
[(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide (PubChem CID 11327813) has the molecular formula C19H26BrNO3S and a molecular weight of 428.39 g/mol. Its IUPAC name is [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide.
| Compound Name | [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide |
|---|---|
| PubChem CID | 11327813 |
| Molecular Formula | C19H26BrNO3S |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | [(3R)-1-prop-2-enyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylpent-4-enoate bromide |
| SMILES | C=CCC(O)(C(=O)O[C@H]1C[N+]2(CC=C)CCC1CC2)c1cccs1.[Br-] |
| InChI | InChI=1S/C19H26NO3S.BrH/c1-3-9-19(22,17-6-5-13-24-17)18(21)23-16-14-20(10-4-2)11-7-15(16)8-12-20;/h3-6,13,15-16,22H,1-2,7-12,14H2;1H/q+1;/p-1/t15?,16-,19?,20?;/m0./s1 |
| InChIKey | KIHVEFBRJAHMIC-QIFMIYHQSA-M |
| XLogP | -0.15 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|