C22H30NO5S2+ — CID 11455395
[(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 11455395) has the molecular formula C22H30NO5S2+ and a molecular weight of 452.62 g/mol. Its IUPAC name is [(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 11455395 |
| Molecular Formula | C22H30NO5S2+ |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [(3R)-1-[2-(2-methoxyethoxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | COCCOCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C22H30NO5S2/c1-26-12-13-27-11-10-23-8-6-17(7-9-23)18(16-23)28-21(24)22(25,19-4-2-14-29-19)20-5-3-15-30-20/h2-5,14-15,17-18,25H,6-13,16H2,1H3/q+1/t17?,18-,23?/m0/s1 |
| InChIKey | WFMXNATVVVIFIZ-OTQYULQBSA-N |
| XLogP | 2.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|