C26H35N2O5S2+ — CID 67496131
[(3R)-1-[2-(cyclohexylcarbamoyloxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 67496131) has the molecular formula C26H35N2O5S2+ and a molecular weight of 519.71 g/mol. Its IUPAC name is [(3R)-1-[2-(cyclohexylcarbamoyloxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-[2-(cyclohexylcarbamoyloxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 67496131 |
| Molecular Formula | C26H35N2O5S2+ |
| Molecular Weight | 519.71 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [(3R)-1-[2-(cyclohexylcarbamoyloxy)ethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | O=C(NC1CCCCC1)OCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C26H34N2O5S2/c29-24(26(31,22-8-4-16-34-22)23-9-5-17-35-23)33-21-18-28(12-10-19(21)11-13-28)14-15-32-25(30)27-20-6-2-1-3-7-20/h4-5,8-9,16-17,19-21,31H,1-3,6-7,10-15,18H2/p+1/t19?,21-,28?/m0/s1 |
| InChIKey | XTMNDADVFBTQKQ-RPVZNCQLSA-O |
| XLogP | 4.26 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.71 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|