C25H30F3NO7S2 — CID 11180698
ethyl 4-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]butanoate;2,2,2-trifluoroacetate (PubChem CID 11180698) has the molecular formula C25H30F3NO7S2 and a molecular weight of 577.64 g/mol. Its IUPAC name is ethyl 4-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]butanoate;2,2,2-trifluoroacetate.
| Compound Name | ethyl 4-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]butanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11180698 |
| Molecular Formula | C25H30F3NO7S2 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | ethyl 4-[(3R)-3-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxy-1-azoniabicyclo[2.2.2]octan-1-yl]butanoate;2,2,2-trifluoroacetate |
| SMILES | CCOC(=O)CCC[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C23H30NO5S2.C2HF3O2/c1-2-28-21(25)8-3-11-24-12-9-17(10-13-24)18(16-24)29-22(26)23(27,19-6-4-14-30-19)20-7-5-15-31-20;3-2(4,5)1(6)7/h4-7,14-15,17-18,27H,2-3,8-13,16H2,1H3;(H,6,7)/q+1;/p-1/t17?,18-,24?;/m0./s1 |
| InChIKey | FJYCPQMVHUKUGC-SPVPNRHKSA-M |
| XLogP | 2.84 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|