C22H28NO3S2+ — CID 10186820
[(3R)-1-(3-thiophen-2-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylbut-3-enoate (PubChem CID 10186820) has the molecular formula C22H28NO3S2+ and a molecular weight of 418.60 g/mol. Its IUPAC name is [(3R)-1-(3-thiophen-2-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylbut-3-enoate.
| Compound Name | [(3R)-1-(3-thiophen-2-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylbut-3-enoate |
|---|---|
| PubChem CID | 10186820 |
| Molecular Formula | C22H28NO3S2+ |
| Molecular Weight | 418.60 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | [(3R)-1-(3-thiophen-2-ylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2-thiophen-2-ylbut-3-enoate |
| SMILES | C=CC(O)(C(=O)O[C@H]1C[N+]2(CCCc3cccs3)CCC1CC2)c1cccs1 |
| InChI | InChI=1S/C22H28NO3S2/c1-2-22(25,20-8-5-15-28-20)21(24)26-19-16-23(12-9-17(19)10-13-23)11-3-6-18-7-4-14-27-18/h2,4-5,7-8,14-15,17,19,25H,1,3,6,9-13,16H2/q+1/t17?,19-,22?,23?/m0/s1 |
| InChIKey | JLMORMLCIQLKGV-ONVZLNGMSA-N |
| XLogP | 3.97 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|