C27H36NO3S+ — CID 10281378
[(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate (PubChem CID 10281378) has the molecular formula C27H36NO3S+ and a molecular weight of 454.66 g/mol. Its IUPAC name is [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate.
| Compound Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 10281378 |
| Molecular Formula | C27H36NO3S+ |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | [(3R)-1-(3-phenylpropyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CCCc3ccccc3)CCC1CC2)[C@@](O)(c1cccs1)C1CCCC1 |
| InChI | InChI=1S/C27H36NO3S/c29-26(27(30,23-11-4-5-12-23)25-13-7-19-32-25)31-24-20-28(17-14-22(24)15-18-28)16-6-10-21-8-2-1-3-9-21/h1-3,7-9,13,19,22-24,30H,4-6,10-12,14-18,20H2/q+1/t22?,24-,27-,28?/m0/s1 |
| InChIKey | PWOBRFZIUNJABF-LDTXTPANSA-N |
| XLogP | 4.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|