C29H35F3N2O8S — CID 10145904
[(3R)-1-[3-(4-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate (PubChem CID 10145904) has the molecular formula C29H35F3N2O8S and a molecular weight of 628.67 g/mol. Its IUPAC name is [(3R)-1-[3-(4-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate.
| Compound Name | [(3R)-1-[3-(4-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10145904 |
| Molecular Formula | C29H35F3N2O8S |
| Molecular Weight | 628.67 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | [(3R)-1-[3-(4-nitrophenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate;2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@H]1C[N+]2(CCCOc3ccc([N+](=O)[O-])cc3)CCC1CC2)[C@](O)(c1cccs1)C1CCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C27H35N2O6S.C2HF3O2/c30-26(27(31,21-5-1-2-6-21)25-7-3-18-36-25)35-24-19-29(15-12-20(24)13-16-29)14-4-17-34-23-10-8-22(9-11-23)28(32)33;3-2(4,5)1(6)7/h3,7-11,18,20-21,24,31H,1-2,4-6,12-17,19H2;(H,6,7)/q+1;/p-1/t20?,24-,27+,29?;/m0./s1 |
| InChIKey | MRITUWHKIYEGFR-AUMKFSQYSA-M |
| XLogP | 3.95 |
| TPSA | 139.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.67 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|