C24H36BrNO3S — CID 11454801
[(3R)-1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide (PubChem CID 11454801) has the molecular formula C24H36BrNO3S and a molecular weight of 498.53 g/mol. Its IUPAC name is [(3R)-1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide.
| Compound Name | [(3R)-1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 11454801 |
| Molecular Formula | C24H36BrNO3S |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | [(3R)-1-(4-methylpent-3-enyl)-1-azoniabicyclo[2.2.2]octan-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-thiophen-2-ylacetate bromide |
| SMILES | CC(C)=CCC[N+]12CCC(CC1)[C@@H](OC(=O)[C@](O)(c1cccs1)C1CCCC1)C2.[Br-] |
| InChI | InChI=1S/C24H36NO3S.BrH/c1-18(2)7-5-13-25-14-11-19(12-15-25)21(17-25)28-23(26)24(27,20-8-3-4-9-20)22-10-6-16-29-22;/h6-7,10,16,19-21,27H,3-5,8-9,11-15,17H2,1-2H3;1H/q+1;/p-1/t19?,21-,24+,25?;/m0./s1 |
| InChIKey | ZNGJAJGPDFGBMD-NHMHNLMRSA-M |
| XLogP | 1.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|