C27H32NO4S2+ — CID 129151937
[1-[1-(3-methylphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 129151937) has the molecular formula C27H32NO4S2+ and a molecular weight of 498.69 g/mol. Its IUPAC name is [1-[1-(3-methylphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [1-[1-(3-methylphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 129151937 |
| Molecular Formula | C27H32NO4S2+ |
| Molecular Weight | 498.69 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | [1-[1-(3-methylphenoxy)propyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | CCC(Oc1cccc(C)c1)[N+]12CCC(CC1)C(OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C27H32NO4S2/c1-3-25(31-21-8-4-7-19(2)17-21)28-13-11-20(12-14-28)22(18-28)32-26(29)27(30,23-9-5-15-33-23)24-10-6-16-34-24/h4-10,15-17,20,22,25,30H,3,11-14,18H2,1-2H3/q+1 |
| InChIKey | WXCOXBDYOINFFR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.69 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|