C22H26N3O5S2+ — CID 87456209
[(3R)-1-[2-amino-1-(3H-1,2-oxazol-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate (PubChem CID 87456209) has the molecular formula C22H26N3O5S2+ and a molecular weight of 476.60 g/mol. Its IUPAC name is [(3R)-1-[2-amino-1-(3H-1,2-oxazol-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate.
| Compound Name | [(3R)-1-[2-amino-1-(3H-1,2-oxazol-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|---|
| PubChem CID | 87456209 |
| Molecular Formula | C22H26N3O5S2+ |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(3R)-1-[2-amino-1-(3H-1,2-oxazol-2-yl)-2-oxoethyl]-1-azoniabicyclo[2.2.2]octan-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate |
| SMILES | NC(=O)C(N1CC=CO1)[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)c1cccs1)C2 |
| InChI | InChI=1S/C22H25N3O5S2/c23-19(26)20(24-8-3-11-29-24)25-9-6-15(7-10-25)16(14-25)30-21(27)22(28,17-4-1-12-31-17)18-5-2-13-32-18/h1-5,11-13,15-16,20,28H,6-10,14H2,(H-,23,26)/p+1/t15?,16-,20?,25?/m0/s1 |
| InChIKey | SJOQKZDKTGOOKS-QFACKKDNSA-O |
| XLogP | 1.77 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|