C23H26BrNO4S2 — CID 11756556
[(3R)-1-methyl-1-(2-phenoxyethyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (PubChem CID 11756556) has the molecular formula C23H26BrNO4S2 and a molecular weight of 524.50 g/mol. Its IUPAC name is [(3R)-1-methyl-1-(2-phenoxyethyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide.
| Compound Name | [(3R)-1-methyl-1-(2-phenoxyethyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 11756556 |
| Molecular Formula | C23H26BrNO4S2 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | [(3R)-1-methyl-1-(2-phenoxyethyl)pyrrolidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| SMILES | C[N+]1(CCOc2ccccc2)CC[C@@H](OC(=O)C(O)(c2cccs2)c2cccs2)C1.[Br-] |
| InChI | InChI=1S/C23H26NO4S2.BrH/c1-24(13-14-27-18-7-3-2-4-8-18)12-11-19(17-24)28-22(25)23(26,20-9-5-15-29-20)21-10-6-16-30-21;/h2-10,15-16,19,26H,11-14,17H2,1H3;1H/q+1;/p-1/t19-,24?;/m1./s1 |
| InChIKey | FOQAJEQUIULQAL-RCDSEZGQSA-M |
| XLogP | 0.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|