C25H30BrNO3S2 — CID 11191882
[(1R,3R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide (PubChem CID 11191882) has the molecular formula C25H30BrNO3S2 and a molecular weight of 536.56 g/mol. Its IUPAC name is [(1R,3R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide.
| Compound Name | [(1R,3R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 11191882 |
| Molecular Formula | C25H30BrNO3S2 |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | [(1R,3R)-1-methyl-1-(3-phenylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-dithiophen-2-ylacetate bromide |
| SMILES | C[N@@+]1(CCCc2ccccc2)CCC[C@@H](OC(=O)C(O)(c2cccs2)c2cccs2)C1.[Br-] |
| InChI | InChI=1S/C25H30NO3S2.BrH/c1-26(15-5-11-20-9-3-2-4-10-20)16-6-12-21(19-26)29-24(27)25(28,22-13-7-17-30-22)23-14-8-18-31-23;/h2-4,7-10,13-14,17-18,21,28H,5-6,11-12,15-16,19H2,1H3;1H/q+1;/p-1/t21-,26-;/m1./s1 |
| InChIKey | JEMXUWNBHURRDC-JEHHVLJISA-M |
| XLogP | 1.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|