C27H32N3O3+ — CID 66902209
[(3R)-1-methyl-1-(3-pyrazin-2-ylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate (PubChem CID 66902209) has the molecular formula C27H32N3O3+ and a molecular weight of 446.57 g/mol. Its IUPAC name is [(3R)-1-methyl-1-(3-pyrazin-2-ylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate.
| Compound Name | [(3R)-1-methyl-1-(3-pyrazin-2-ylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 66902209 |
| Molecular Formula | C27H32N3O3+ |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | [(3R)-1-methyl-1-(3-pyrazin-2-ylpropyl)piperidin-1-ium-3-yl] 2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(CCCc2cnccn2)CCC[C@@H](OC(=O)C(O)(c2ccccc2)c2ccccc2)C1 |
| InChI | InChI=1S/C27H32N3O3/c1-30(18-8-14-24-20-28-16-17-29-24)19-9-15-25(21-30)33-26(31)27(32,22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,10-13,16-17,20,25,32H,8-9,14-15,18-19,21H2,1H3/q+1/t25-,30?/m1/s1 |
| InChIKey | PDUINXYXKBODKO-GOWJNXQMSA-N |
| XLogP | 3.50 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|