C18H19NO2 — CID 110929887
2-hydroxy-N-(2-methylcyclopropyl)-2,2-diphenylacetamide (PubChem CID 110929887) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-hydroxy-N-(2-methylcyclopropyl)-2,2-diphenylacetamide.
| Compound Name | 2-hydroxy-N-(2-methylcyclopropyl)-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 110929887 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 2-hydroxy-N-(2-methylcyclopropyl)-2,2-diphenylacetamide |
| SMILES | CC1CC1NC(=O)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-13-12-16(13)19-17(20)18(21,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13,16,21H,12H2,1H3,(H,19,20) |
| InChIKey | IJEPXYSOMYHEMA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |