C17H27ClN2O — CID 120607906
2-amino-N-(2,3-dimethylcyclohexyl)-2-phenylpropanamide;hydrochloride (PubChem CID 120607906) has the molecular formula C17H27ClN2O and a molecular weight of 310.87 g/mol. Its IUPAC name is 2-amino-N-(2,3-dimethylcyclohexyl)-2-phenylpropanamide;hydrochloride.
| Compound Name | 2-amino-N-(2,3-dimethylcyclohexyl)-2-phenylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120607906 |
| Molecular Formula | C17H27ClN2O |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-amino-N-(2,3-dimethylcyclohexyl)-2-phenylpropanamide;hydrochloride |
| SMILES | CC1CCCC(NC(=O)C(C)(N)c2ccccc2)C1C.Cl |
| InChI | InChI=1S/C17H26N2O.ClH/c1-12-8-7-11-15(13(12)2)19-16(20)17(3,18)14-9-5-4-6-10-14;/h4-6,9-10,12-13,15H,7-8,11,18H2,1-3H3,(H,19,20);1H |
| InChIKey | JHNOGXGYSBZYIU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |