C18H20N2OS — CID 120587017
2-amino-N-(3,4-dihydro-2H-thiochromen-4-yl)-2-phenylpropanamide (PubChem CID 120587017) has the molecular formula C18H20N2OS and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-amino-N-(3,4-dihydro-2H-thiochromen-4-yl)-2-phenylpropanamide.
| Compound Name | 2-amino-N-(3,4-dihydro-2H-thiochromen-4-yl)-2-phenylpropanamide |
|---|---|
| PubChem CID | 120587017 |
| Molecular Formula | C18H20N2OS |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 2-amino-N-(3,4-dihydro-2H-thiochromen-4-yl)-2-phenylpropanamide |
| SMILES | CC(N)(C(=O)NC1CCSc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C18H20N2OS/c1-18(19,13-7-3-2-4-8-13)17(21)20-15-11-12-22-16-10-6-5-9-14(15)16/h2-10,15H,11-12,19H2,1H3,(H,20,21) |
| InChIKey | XYAIOEKZDOWALQ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |