C17H14F3NOS — CID 7536993
N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(trifluoromethyl)benzamide (PubChem CID 7536993) has the molecular formula C17H14F3NOS and a molecular weight of 337.37 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 7536993 |
| Molecular Formula | C17H14F3NOS |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(N[C@H]1CCSc2ccccc21)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3NOS/c18-17(19,20)12-5-3-4-11(10-12)16(22)21-14-8-9-23-15-7-2-1-6-13(14)15/h1-7,10,14H,8-9H2,(H,21,22)/t14-/m0/s1 |
| InChIKey | PYONYXGRJGFXON-AWEZNQCLSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |