C18H20N2O3S2 — CID 26006999
N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(ethylsulfamoyl)benzamide (PubChem CID 26006999) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(ethylsulfamoyl)benzamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(ethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 26006999 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(ethylsulfamoyl)benzamide |
| SMILES | CCNS(=O)(=O)c1cccc(C(=O)N[C@@H]2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-2-19-25(22,23)14-7-5-6-13(12-14)18(21)20-16-10-11-24-17-9-4-3-8-15(16)17/h3-9,12,16,19H,2,10-11H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | HTKIGYTVFHQDJV-MRXNPFEDSA-N |
| XLogP | 2.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |