C21H20N2O4S2 — CID 41040754
N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 41040754) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 41040754 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(N[C@@H]1CCSc2ccccc21)c1cccc(S(=O)(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C21H20N2O4S2/c24-21(23-19-10-12-28-20-9-2-1-8-18(19)20)15-5-3-7-17(13-15)29(25,26)22-14-16-6-4-11-27-16/h1-9,11,13,19,22H,10,12,14H2,(H,23,24)/t19-/m1/s1 |
| InChIKey | MEUUTIWJIDTXFI-LJQANCHMSA-N |
| XLogP | 3.72 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |