C18H20N2O3S2 — CID 7678486
N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(dimethylsulfamoyl)benzamide (PubChem CID 7678486) has the molecular formula C18H20N2O3S2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 7678486 |
| Molecular Formula | C18H20N2O3S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-3-(dimethylsulfamoyl)benzamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)N[C@H]2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O3S2/c1-20(2)25(22,23)14-7-5-6-13(12-14)18(21)19-16-10-11-24-17-9-4-3-8-15(16)17/h3-9,12,16H,10-11H2,1-2H3,(H,19,21)/t16-/m0/s1 |
| InChIKey | LOJYHBIVPACEFR-INIZCTEOSA-N |
| XLogP | 2.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |