C17H18N2O3S2 — CID 41176413
N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(methylsulfamoyl)benzamide (PubChem CID 41176413) has the molecular formula C17H18N2O3S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(methylsulfamoyl)benzamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(methylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 41176413 |
| Molecular Formula | C17H18N2O3S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3-(methylsulfamoyl)benzamide |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)N[C@@H]2CCSc3ccccc32)c1 |
| InChI | InChI=1S/C17H18N2O3S2/c1-18-24(21,22)13-6-4-5-12(11-13)17(20)19-15-9-10-23-16-8-3-2-7-14(15)16/h2-8,11,15,18H,9-10H2,1H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | YMJQAWBOQYYFSB-OAHLLOKOSA-N |
| XLogP | 2.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |