C22H19N3O5S2 — CID 41083223
N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-[(3-nitrophenyl)sulfonylamino]benzamide (PubChem CID 41083223) has the molecular formula C22H19N3O5S2 and a molecular weight of 469.54 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-[(3-nitrophenyl)sulfonylamino]benzamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-[(3-nitrophenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 41083223 |
| Molecular Formula | C22H19N3O5S2 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-[(3-nitrophenyl)sulfonylamino]benzamide |
| SMILES | O=C(N[C@H]1CCSc2ccccc21)c1ccc(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H19N3O5S2/c26-22(23-20-12-13-31-21-7-2-1-6-19(20)21)15-8-10-16(11-9-15)24-32(29,30)18-5-3-4-17(14-18)25(27)28/h1-11,14,20,24H,12-13H2,(H,23,26)/t20-/m0/s1 |
| InChIKey | FSJVAUUWNGBPOI-FQEVSTJZSA-N |
| XLogP | 4.36 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|