C21H24N2O3S2 — CID 8891035
N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 8891035) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 8891035 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | O=C(N[C@@H]1CCSc2ccccc21)c1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N2O3S2/c24-21(22-19-12-15-27-20-7-3-2-6-18(19)20)16-8-10-17(11-9-16)28(25,26)23-13-4-1-5-14-23/h2-3,6-11,19H,1,4-5,12-15H2,(H,22,24)/t19-/m1/s1 |
| InChIKey | FXZBBWKGUSMRCY-LJQANCHMSA-N |
| XLogP | 3.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |