C22H26N2O3S — CID 51273599
N-(2,3-dihydro-1H-inden-1-yl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 51273599) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 51273599 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-2-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)NC1CCc2ccccc21 |
| InChI | InChI=1S/C22H26N2O3S/c25-22(23-21-13-10-18-6-2-3-7-20(18)21)16-17-8-11-19(12-9-17)28(26,27)24-14-4-1-5-15-24/h2-3,6-9,11-12,21H,1,4-5,10,13-16H2,(H,23,25) |
| InChIKey | YHDZSKNLSVKMBU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |