C22H25N3O4S — CID 25414621
N'-(4-pyrrolidin-1-ylsulfonylphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxamide (PubChem CID 25414621) has the molecular formula C22H25N3O4S and a molecular weight of 427.53 g/mol. Its IUPAC name is N'-(4-pyrrolidin-1-ylsulfonylphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxamide.
| Compound Name | N'-(4-pyrrolidin-1-ylsulfonylphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxamide |
|---|---|
| PubChem CID | 25414621 |
| Molecular Formula | C22H25N3O4S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N'-(4-pyrrolidin-1-ylsulfonylphenyl)-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]oxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCC2)cc1)C(=O)N[C@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C22H25N3O4S/c26-21(22(27)24-20-9-5-7-16-6-1-2-8-19(16)20)23-17-10-12-18(13-11-17)30(28,29)25-14-3-4-15-25/h1-2,6,8,10-13,20H,3-5,7,9,14-15H2,(H,23,26)(H,24,27)/t20-/m0/s1 |
| InChIKey | QTTXLKZSGAXJED-FQEVSTJZSA-N |
| XLogP | 2.60 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|