C19H20N2O3S2 — CID 41041142
N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 41041142) has the molecular formula C19H20N2O3S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 41041142 |
| Molecular Formula | C19H20N2O3S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | N-[(4S)-3,4-dihydro-2H-thiochromen-4-yl]-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)N[C@H]2CCSc3ccccc32)cc1 |
| InChI | InChI=1S/C19H20N2O3S2/c1-2-12-20-26(23,24)15-9-7-14(8-10-15)19(22)21-17-11-13-25-18-6-4-3-5-16(17)18/h2-10,17,20H,1,11-13H2,(H,21,22)/t17-/m0/s1 |
| InChIKey | MSFMYWWKLQXJRU-KRWDZBQOSA-N |
| XLogP | 3.12 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|