C14H18N2OS — CID 79285946
N-(3,4-dihydro-2H-thiochromen-4-yl)-2-(prop-2-enylamino)acetamide (PubChem CID 79285946) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-thiochromen-4-yl)-2-(prop-2-enylamino)acetamide.
| Compound Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-2-(prop-2-enylamino)acetamide |
|---|---|
| PubChem CID | 79285946 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | N-(3,4-dihydro-2H-thiochromen-4-yl)-2-(prop-2-enylamino)acetamide |
| SMILES | C=CCNCC(=O)NC1CCSc2ccccc21 |
| InChI | InChI=1S/C14H18N2OS/c1-2-8-15-10-14(17)16-12-7-9-18-13-6-4-3-5-11(12)13/h2-6,12,15H,1,7-10H2,(H,16,17) |
| InChIKey | MVCABGAEOQXJLX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|