C21H20N2OS — CID 39547510
N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-2-(4-pyrrol-1-ylphenyl)acetamide (PubChem CID 39547510) has the molecular formula C21H20N2OS and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-2-(4-pyrrol-1-ylphenyl)acetamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-2-(4-pyrrol-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 39547510 |
| Molecular Formula | C21H20N2OS |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-2-(4-pyrrol-1-ylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-n2cccc2)cc1)N[C@@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C21H20N2OS/c24-21(22-19-11-14-25-20-6-2-1-5-18(19)20)15-16-7-9-17(10-8-16)23-12-3-4-13-23/h1-10,12-13,19H,11,14-15H2,(H,22,24)/t19-/m1/s1 |
| InChIKey | DUQGQRIRIULQDW-LJQANCHMSA-N |
| XLogP | 4.37 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |