C17H15N3OS — CID 25324948
N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 25324948) has the molecular formula C17H15N3OS and a molecular weight of 309.39 g/mol. Its IUPAC name is N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 25324948 |
| Molecular Formula | C17H15N3OS |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[(4R)-3,4-dihydro-2H-thiochromen-4-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | O=C(N[C@@H]1CCSc2ccccc21)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C17H15N3OS/c21-17(11-5-6-14-15(9-11)19-10-18-14)20-13-7-8-22-16-4-2-1-3-12(13)16/h1-6,9-10,13H,7-8H2,(H,18,19)(H,20,21)/t13-/m1/s1 |
| InChIKey | RJPFFCPDINTWER-CYBMUJFWSA-N |
| XLogP | 3.53 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |