C22H27BrN2O2 — CID 139752454
2-hydroxy-N-[(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-diphenylacetamide bromide (PubChem CID 139752454) has the molecular formula C22H27BrN2O2 and a molecular weight of 431.37 g/mol. Its IUPAC name is 2-hydroxy-N-[(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-diphenylacetamide bromide.
| Compound Name | 2-hydroxy-N-[(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-diphenylacetamide bromide |
|---|---|
| PubChem CID | 139752454 |
| Molecular Formula | C22H27BrN2O2 |
| Molecular Weight | 431.37 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 2-hydroxy-N-[(3S)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl]-2,2-diphenylacetamide bromide |
| SMILES | C[N+]12CCC(CC1)[C@H](NC(=O)C(O)(c1ccccc1)c1ccccc1)C2.[Br-] |
| InChI | InChI=1S/C22H26N2O2.BrH/c1-24-14-12-17(13-15-24)20(16-24)23-21(25)22(26,18-8-4-2-5-9-18)19-10-6-3-7-11-19;/h2-11,17,20,26H,12-16H2,1H3;1H/t17?,20-,24?;/m1./s1 |
| InChIKey | IWJDJHREIVBWHY-SZEMVBEASA-N |
| XLogP | -0.72 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.37 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|