C21H27NO4 — CID 23615823
1,1-dimethylpiperidin-1-ium-3-ol;2-hydroxy-2,2-diphenylacetate (PubChem CID 23615823) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is 1,1-dimethylpiperidin-1-ium-3-ol;2-hydroxy-2,2-diphenylacetate.
| Compound Name | 1,1-dimethylpiperidin-1-ium-3-ol;2-hydroxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 23615823 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1,1-dimethylpiperidin-1-ium-3-ol;2-hydroxy-2,2-diphenylacetate |
| SMILES | C[N+]1(C)CCCC(O)C1.O=C([O-])C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H12O3.C7H16NO/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-8(2)5-3-4-7(9)6-8/h1-10,17H,(H,15,16);7,9H,3-6H2,1-2H3/q;+1/p-1 |
| InChIKey | XIEMIRDYICEPSR-UHFFFAOYSA-M |
| XLogP | 0.89 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|